Phenylpropanoic acids
Medchemexpress LLC Hydrocinnamic acid-d5 | 35845-62-6 | 99.7% | 155.21 g/mol | C9H5D5O2 | 100mg
Hydrocinnamic acid-d5 is the deuterium labeled Hydrocinnamic acid[1] Hydrocinnamic acid is the major rhizospheric compound with known growth regulatory activities[2]
Aobchem 3-(3-Methoxyphenyl)-1-phenylprop-2-yn-1-ol | 95% | CAS 1786443-11-5 | C16H14O2 | 1g
3-(3-Methoxyphenyl)-1-phenylprop-2-yn-1-ol | 95% | CAS 1786443-11-5 | C16H14O2 | 1g
Selleck Chemical LLC TUG-891-5mg
TUG-891 is a potent and selective agonist of the long chain free fatty acid (LCFA) receptor 4 (FFA4/GPR120), which demonstrates both potential opportunity and possible challenges to therapeutic agonism.
Chemscene ChemScene | 3-Hydroxy-3-phenylpropanoic acid | 10G | CS-W021936 | 0.97 | 3480-87-3| MFCD00137907 | 166.18
ChemScene | 3-Hydroxy-3-phenylpropanoic acid | 10G | CS-W021936 | 0.97 | 3480-87-3| MFCD00137907 | 166.18
Chemscene ChemScene | p-(Methoxycarbonylmethyl)aniline | 100G | CS-0028736 | 0.98 | 39552-81-3| MFCD06200783 | 165.19
ChemScene | p-(Methoxycarbonylmethyl)aniline | 100G | CS-0028736 | 0.98 | 39552-81-3| MFCD06200783 | 165.19
Accela Chembio Inc 2-benzylacrylic Acid | 100g | 5669-19-2 | MFCD00854174 | 97+% | Shelf Life: 1620 Days | Regular
2-benzylacrylic Acid | 100g | 5669-19-2 | MFCD00854174 | 97+% | Shelf Life: 1620 Days | Regular
Medchemexpress LLC Hydrocinnamic acid-d5 | 35845-62-6 | 99.7% | 155.21 g·mol⁻1 | C9H5D5O2 | 25mg
Hydrocinnamic acid-d5 is the deuterium labeled Hydrocinnamic acid[1] Hydrocinnamic acid is the major rhizospheric compound with known growth regulatory activities[2]
eMolecules 459-31-4 | 3-(4-Fluorophenyl)propanoic acid | Ambeed | MFCD00060327 | 168.167 | C9H9FO2 | 97.000 | OC(=O)CCc1ccc(F)cc1 | 25g | 528567885
3-(4-Fluorophenyl)propanoic acid | Ambeed | 459-31-4 | MFCD00060327 | 168.167 | C9H9FO2 | 97.000 | OC(=O)CCc1ccc(F)cc1 | 25g | 528567885
Accela Chembio Inc 3-(4-fluorophenyl)propionic Acid | 25g | 459-31-4 | MFCD00060327 | 98% | Shelf Life: 2160 Days | Regular
3-(4-fluorophenyl)propionic Acid | 25g | 459-31-4 | MFCD00060327 | 98% | Shelf Life: 2160 Days | Regular
eMolecules 2096333-95-6 | 2-(Methanesulfonyl(N-methoxymethyl)amino)pyrimidine-5-boronic acid, pinacol ester | Combi-Blocks | MFCD19684127 | 343.210 | C13H22BN3O5S | 96.000 | COCN(c1ncc(cn1)B1OC(C)(C)C(C)(C)O1)S(C)(=O)=O | 1g | 117545104
2-(Methanesulfonyl(N-methoxymethyl)amino)pyrimidine-5-boronic acid, pinacol ester | Combi-Blocks | 2096333-95-6 | MFCD19684127 | 343.210 | C13H22BN3O5S | 96.000 | COCN(c1ncc(cn1)B1OC(C)(C)C(C)(C)O1)S(C)(=O)=O | 1g | 117545104
eMolecules 5472-68-4 | AstaTech | 24-DICHLORO-DL-PHENYLALANINE | 0.25g | 718055058 | 60594 | 97 | MFCD05227922 | 234.08 | C9H9Cl2NO2
AstaTech | 24-DICHLORO-DL-PHENYLALANINE | 0.25g | 718055058 | 60594 | 97.000 | 5472-68-4 | MFCD05227922 | 234.080 | C9H9Cl2NO2
Apexbio Technology LLC Glycoprotein B (485-492) 25mg
Glycoprotein B 485-492 is a viral glycoprotein-derived peptide fragment from herpes simplex virus (HSV) It is designed to facilitate virus-cell membrane fusion by interacting with cellular membranes thereby promoting HSV entry into host cells Glycoprotein B 485-492 exerts its biological activity primarily through its role as part of the viral fusion machinery in conjunction with glycoproteins H and L Based on these properties Glycoprotein B 485-492 holds research potential in investigating HSV fusion mechanisms antiviral development and antigen-antibody interaction studies in viral entry
Accela Chembio Inc 3-(2-bromophenyl)propionic Acid | 25g | 15115-58-9 | MFCD01310791 | 97+% | Shelf Life: 1260 Days | Light Sensitive
3-(2-bromophenyl)propionic Acid | 25g | 15115-58-9 | MFCD01310791 | 97+% | Shelf Life: 1260 Days | Light Sensitive
Chem-Impex International, Inc. D-b-Phenyllactic acid | 7326-19-4 | MFCD00078062 | 25G
D-b-Phenyllactic acid, 7326-19-4, MFCD00078062, 25G